dihydroxyphosphanyloxyphosphinous acid

H4O4P2 — CID 173001305

IUPACdihydroxyphosphanyloxyphosphinous acid
SMILESOPOP(O)O
InChIInChI=1S/H4O4P2/c1-5-4-6(2)3/h1-3,5H
InChIKeyOBRJSTJETCAGDG-UHFFFAOYSA-N
MW129.98 g/mol
LogP-0.28
Rot. Bonds2

About dihydroxyphosphanyloxyphosphinous acid

dihydroxyphosphanyloxyphosphinous acid (PubChem CID 173001305) has the molecular formula H4O4P2 and a molecular weight of 129.98 g/mol. Its IUPAC name is dihydroxyphosphanyloxyphosphinous acid.

Molecular Properties

Compound Namedihydroxyphosphanyloxyphosphinous acid
PubChem CID173001305
Molecular FormulaH4O4P2
Molecular Weight129.98 g/mol
Exact Mass129.96
IUPAC Namedihydroxyphosphanyloxyphosphinous acid
SMILESOPOP(O)O
InChIInChI=1S/H4O4P2/c1-5-4-6(2)3/h1-3,5H
InChIKeyOBRJSTJETCAGDG-UHFFFAOYSA-N
XLogP-0.28
TPSA69.92 Ų
H-Bond Donors3
H-Bond Acceptors4
Rotatable Bonds2
Heavy Atoms6
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500129.98
LogP ≤ 5-0.28
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'phosphor', 'substructure': 'N/A'}

Analyze dihydroxyphosphanyloxyphosphinous acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of dihydroxyphosphanyloxyphosphinous acid?
The IUPAC name of dihydroxyphosphanyloxyphosphinous acid (CID 173001305) is dihydroxyphosphanyloxyphosphinous acid.
What is the SMILES notation for dihydroxyphosphanyloxyphosphinous acid?
The canonical SMILES for dihydroxyphosphanyloxyphosphinous acid is OPOP(O)O.
What is the InChIKey of dihydroxyphosphanyloxyphosphinous acid?
The InChIKey is OBRJSTJETCAGDG-UHFFFAOYSA-N. The full InChI is InChI=1S/H4O4P2/c1-5-4-6(2)3/h1-3,5H.
What are the key properties of dihydroxyphosphanyloxyphosphinous acid?
dihydroxyphosphanyloxyphosphinous acid has a molecular weight of 129.98 g/mol, XLogP of -0.28, 2 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for dihydroxyphosphanyloxyphosphinous acid is sourced from PubChem (CID 173001305), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).