C21H38 — CID 173001307
3,5,5,10-tetramethyl-7-(3-methylbutylidene)dodeca-1,8-diene (PubChem CID 173001307) has the molecular formula C21H38 and a molecular weight of 290.54 g/mol. Its IUPAC name is 3,5,5,10-tetramethyl-7-(3-methylbutylidene)dodeca-1,8-diene.
| Compound Name | 3,5,5,10-tetramethyl-7-(3-methylbutylidene)dodeca-1,8-diene |
|---|---|
| PubChem CID | 173001307 |
| Molecular Formula | C21H38 |
| Molecular Weight | 290.54 g/mol |
| Exact Mass | 290.30 |
| IUPAC Name | 3,5,5,10-tetramethyl-7-(3-methylbutylidene)dodeca-1,8-diene |
| SMILES | C=CC(C)CC(C)(C)CC(C=CC(C)CC)=CCC(C)C |
| InChI | InChI=1S/C21H38/c1-9-18(5)12-14-20(13-11-17(3)4)16-21(7,8)15-19(6)10-2/h10,12-14,17-19H,2,9,11,15-16H2,1,3-8H3 |
| InChIKey | IZPDYRCDZUOPNL-UHFFFAOYSA-N |
| XLogP | 7.19 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.54 |
| LogP ≤ 5 | 7.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|