About lithium;5-[2-(azepan-1-yl)ethyl]thiophene-2-carboxylic acid;hydride
lithium;5-[2-(azepan-1-yl)ethyl]thiophene-2-carboxylic acid;hydride (PubChem CID 173001875) has the molecular formula C13H20LiNO2S
and a molecular weight of 261.32 g/mol. Its IUPAC name is lithium;5-[2-(azepan-1-yl)ethyl]thiophene-2-carboxylic acid;hydride.
Molecular Properties
| Compound Name | lithium;5-[2-(azepan-1-yl)ethyl]thiophene-2-carboxylic acid;hydride |
| PubChem CID | 173001875 |
| Molecular Formula | C13H20LiNO2S |
| Molecular Weight | 261.32 g/mol |
| Exact Mass | 261.14 |
| IUPAC Name | lithium;5-[2-(azepan-1-yl)ethyl]thiophene-2-carboxylic acid;hydride |
| SMILES | O=C(O)c1ccc(CCN2CCCCCC2)s1.[H-].[Li+] |
| InChI | InChI=1S/C13H19NO2S.Li.H/c15-13(16)12-6-5-11(17-12)7-10-14-8-3-1-2-4-9-14;;/h5-6H,1-4,7-10H2,(H,15,16);;/q;+1;-1 |
| InChIKey | PBZSKQLISINBCS-UHFFFAOYSA-N |
| XLogP | -0.02 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.32 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze lithium;5-[2-(azepan-1-yl)ethyl]thiophene-2-carboxylic acid;hydride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of lithium;5-[2-(azepan-1-yl)ethyl]thiophene-2-carboxylic acid;hydride?
The IUPAC name of lithium;5-[2-(azepan-1-yl)ethyl]thiophene-2-carboxylic acid;hydride (CID 173001875) is lithium;5-[2-(azepan-1-yl)ethyl]thiophene-2-carboxylic acid;hydride.
What is the SMILES notation for lithium;5-[2-(azepan-1-yl)ethyl]thiophene-2-carboxylic acid;hydride?
The canonical SMILES for lithium;5-[2-(azepan-1-yl)ethyl]thiophene-2-carboxylic acid;hydride is O=C(O)c1ccc(CCN2CCCCCC2)s1.[H-].[Li+].
What is the InChIKey of lithium;5-[2-(azepan-1-yl)ethyl]thiophene-2-carboxylic acid;hydride?
The InChIKey is PBZSKQLISINBCS-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19NO2S.Li.H/c15-13(16)12-6-5-11(17-12)7-10-14-8-3-1-2-4-9-14;;/h5-6H,1-4,7-10H2,(H,15,16);;/q;+1;-1.
What are the key properties of lithium;5-[2-(azepan-1-yl)ethyl]thiophene-2-carboxylic acid;hydride?
lithium;5-[2-(azepan-1-yl)ethyl]thiophene-2-carboxylic acid;hydride has a molecular weight of 261.32 g/mol, XLogP of -0.02, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for lithium;5-[2-(azepan-1-yl)ethyl]thiophene-2-carboxylic acid;hydride is sourced from PubChem (CID 173001875), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).