About ethylidenethiourea;silver
ethylidenethiourea;silver (PubChem CID 173001938) has the molecular formula C3H6AgN2S
and a molecular weight of 210.03 g/mol. Its IUPAC name is ethylidenethiourea;silver.
Molecular Properties
| Compound Name | ethylidenethiourea;silver |
| PubChem CID | 173001938 |
| Molecular Formula | C3H6AgN2S |
| Molecular Weight | 210.03 g/mol |
| Exact Mass | 208.93 |
| IUPAC Name | ethylidenethiourea;silver |
| SMILES | CC=NC(N)=S.[Ag] |
| InChI | InChI=1S/C3H6N2S.Ag/c1-2-5-3(4)6;/h2H,1H3,(H2,4,6); |
| InChIKey | IQHMRJBQVSWCKU-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.03 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze ethylidenethiourea;silver with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethylidenethiourea;silver?
The IUPAC name of ethylidenethiourea;silver (CID 173001938) is ethylidenethiourea;silver.
What is the SMILES notation for ethylidenethiourea;silver?
The canonical SMILES for ethylidenethiourea;silver is CC=NC(N)=S.[Ag].
What is the InChIKey of ethylidenethiourea;silver?
The InChIKey is IQHMRJBQVSWCKU-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H6N2S.Ag/c1-2-5-3(4)6;/h2H,1H3,(H2,4,6);.
What are the key properties of ethylidenethiourea;silver?
ethylidenethiourea;silver has a molecular weight of 210.03 g/mol, XLogP of 0.32, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethylidenethiourea;silver is sourced from PubChem (CID 173001938), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).