About 5-but-3-enylnona-1,8-dien-5-ylsilane
5-but-3-enylnona-1,8-dien-5-ylsilane (PubChem CID 173001967) has the molecular formula C13H24Si
and a molecular weight of 208.42 g/mol. Its IUPAC name is 5-but-3-enylnona-1,8-dien-5-ylsilane.
Molecular Properties
| Compound Name | 5-but-3-enylnona-1,8-dien-5-ylsilane |
| PubChem CID | 173001967 |
| Molecular Formula | C13H24Si |
| Molecular Weight | 208.42 g/mol |
| Exact Mass | 208.16 |
| IUPAC Name | 5-but-3-enylnona-1,8-dien-5-ylsilane |
| SMILES | C=CCCC([SiH3])(CCC=C)CCC=C |
| InChI | InChI=1S/C13H24Si/c1-4-7-10-13(14,11-8-5-2)12-9-6-3/h4-6H,1-3,7-12H2,14H3 |
| InChIKey | FJLDUGCXXGUFLD-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.42 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 5-but-3-enylnona-1,8-dien-5-ylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-but-3-enylnona-1,8-dien-5-ylsilane?
The IUPAC name of 5-but-3-enylnona-1,8-dien-5-ylsilane (CID 173001967) is 5-but-3-enylnona-1,8-dien-5-ylsilane.
What is the SMILES notation for 5-but-3-enylnona-1,8-dien-5-ylsilane?
The canonical SMILES for 5-but-3-enylnona-1,8-dien-5-ylsilane is C=CCCC([SiH3])(CCC=C)CCC=C.
What is the InChIKey of 5-but-3-enylnona-1,8-dien-5-ylsilane?
The InChIKey is FJLDUGCXXGUFLD-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H24Si/c1-4-7-10-13(14,11-8-5-2)12-9-6-3/h4-6H,1-3,7-12H2,14H3.
What are the key properties of 5-but-3-enylnona-1,8-dien-5-ylsilane?
5-but-3-enylnona-1,8-dien-5-ylsilane has a molecular weight of 208.42 g/mol, XLogP of 3.41, 9 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 5-but-3-enylnona-1,8-dien-5-ylsilane is sourced from PubChem (CID 173001967), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).