About 3-prop-2-enylhexa-1,5-dien-2-ylsilane
3-prop-2-enylhexa-1,5-dien-2-ylsilane (PubChem CID 173001992) has the molecular formula C9H16Si
and a molecular weight of 152.31 g/mol. Its IUPAC name is 3-prop-2-enylhexa-1,5-dien-2-ylsilane.
Molecular Properties
| Compound Name | 3-prop-2-enylhexa-1,5-dien-2-ylsilane |
| PubChem CID | 173001992 |
| Molecular Formula | C9H16Si |
| Molecular Weight | 152.31 g/mol |
| Exact Mass | 152.10 |
| IUPAC Name | 3-prop-2-enylhexa-1,5-dien-2-ylsilane |
| SMILES | C=CCC(CC=C)C(=C)[SiH3] |
| InChI | InChI=1S/C9H16Si/c1-4-6-9(7-5-2)8(3)10/h4-5,9H,1-3,6-7H2,10H3 |
| InChIKey | SXJAWSYSCFGYTJ-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 152.31 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3-prop-2-enylhexa-1,5-dien-2-ylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-prop-2-enylhexa-1,5-dien-2-ylsilane?
The IUPAC name of 3-prop-2-enylhexa-1,5-dien-2-ylsilane (CID 173001992) is 3-prop-2-enylhexa-1,5-dien-2-ylsilane.
What is the SMILES notation for 3-prop-2-enylhexa-1,5-dien-2-ylsilane?
The canonical SMILES for 3-prop-2-enylhexa-1,5-dien-2-ylsilane is C=CCC(CC=C)C(=C)[SiH3].
What is the InChIKey of 3-prop-2-enylhexa-1,5-dien-2-ylsilane?
The InChIKey is SXJAWSYSCFGYTJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16Si/c1-4-6-9(7-5-2)8(3)10/h4-5,9H,1-3,6-7H2,10H3.
What are the key properties of 3-prop-2-enylhexa-1,5-dien-2-ylsilane?
3-prop-2-enylhexa-1,5-dien-2-ylsilane has a molecular weight of 152.31 g/mol, XLogP of 1.63, 5 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 3-prop-2-enylhexa-1,5-dien-2-ylsilane is sourced from PubChem (CID 173001992), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).