C15H38N4Si — CID 173002288
1-N,1-N',2-N-tritert-butyl-1-N"-silylpropane-1,1,1,2-tetramine (PubChem CID 173002288) has the molecular formula C15H38N4Si and a molecular weight of 302.58 g/mol. Its IUPAC name is 1-N,1-N',2-N-tritert-butyl-1-N"-silylpropane-1,1,1,2-tetramine.
| Compound Name | 1-N,1-N',2-N-tritert-butyl-1-N"-silylpropane-1,1,1,2-tetramine |
|---|---|
| PubChem CID | 173002288 |
| Molecular Formula | C15H38N4Si |
| Molecular Weight | 302.58 g/mol |
| Exact Mass | 302.29 |
| IUPAC Name | 1-N,1-N',2-N-tritert-butyl-1-N"-silylpropane-1,1,1,2-tetramine |
| SMILES | CC(NC(C)(C)C)C(N[SiH3])(NC(C)(C)C)NC(C)(C)C |
| InChI | InChI=1S/C15H38N4Si/c1-11(16-12(2,3)4)15(19-20,17-13(5,6)7)18-14(8,9)10/h11,16-19H,1-10,20H3 |
| InChIKey | SFAAZKOWOCCFNH-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 48.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.58 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|