C15H33N3Si — CID 173002317
1-N,2-N-diethyl-1-N'-(1-silylcyclohexyl)cyclopentane-1,1,2-triamine (PubChem CID 173002317) has the molecular formula C15H33N3Si and a molecular weight of 283.54 g/mol. Its IUPAC name is 1-N,2-N-diethyl-1-N'-(1-silylcyclohexyl)cyclopentane-1,1,2-triamine.
| Compound Name | 1-N,2-N-diethyl-1-N'-(1-silylcyclohexyl)cyclopentane-1,1,2-triamine |
|---|---|
| PubChem CID | 173002317 |
| Molecular Formula | C15H33N3Si |
| Molecular Weight | 283.54 g/mol |
| Exact Mass | 283.24 |
| IUPAC Name | 1-N,2-N-diethyl-1-N'-(1-silylcyclohexyl)cyclopentane-1,1,2-triamine |
| SMILES | CCNC1CCCC1(NCC)NC1([SiH3])CCCCC1 |
| InChI | InChI=1S/C15H33N3Si/c1-3-16-13-9-8-12-15(13,17-4-2)18-14(19)10-6-5-7-11-14/h13,16-18H,3-12H2,1-2,19H3 |
| InChIKey | AERCDGOGYUMAFJ-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 36.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.54 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|