C14H32N2Si — CID 173002330
1-N,1-N',2-tri(propan-2-yl)-2-silylcyclopentane-1,1-diamine (PubChem CID 173002330) has the molecular formula C14H32N2Si and a molecular weight of 256.51 g/mol. Its IUPAC name is 1-N,1-N',2-tri(propan-2-yl)-2-silylcyclopentane-1,1-diamine.
| Compound Name | 1-N,1-N',2-tri(propan-2-yl)-2-silylcyclopentane-1,1-diamine |
|---|---|
| PubChem CID | 173002330 |
| Molecular Formula | C14H32N2Si |
| Molecular Weight | 256.51 g/mol |
| Exact Mass | 256.23 |
| IUPAC Name | 1-N,1-N',2-tri(propan-2-yl)-2-silylcyclopentane-1,1-diamine |
| SMILES | CC(C)NC1(NC(C)C)CCCC1([SiH3])C(C)C |
| InChI | InChI=1S/C14H32N2Si/c1-10(2)13(17)8-7-9-14(13,15-11(3)4)16-12(5)6/h10-12,15-16H,7-9H2,1-6,17H3 |
| InChIKey | MMMZIXXMBHWKDP-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.51 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|