C3H8ClNaO4S — CID 173003545
sodium;3-chloro-2-hydroxypropane-1-sulfonic acid;hydride (PubChem CID 173003545) has the molecular formula C3H8ClNaO4S and a molecular weight of 198.60 g/mol. Its IUPAC name is sodium;3-chloro-2-hydroxypropane-1-sulfonic acid;hydride.
| Compound Name | sodium;3-chloro-2-hydroxypropane-1-sulfonic acid;hydride |
|---|---|
| PubChem CID | 173003545 |
| Molecular Formula | C3H8ClNaO4S |
| Molecular Weight | 198.60 g/mol |
| Exact Mass | 197.97 |
| IUPAC Name | sodium;3-chloro-2-hydroxypropane-1-sulfonic acid;hydride |
| SMILES | O=S(=O)(O)CC(O)CCl.[H-].[Na+] |
| InChI | InChI=1S/C3H7ClO4S.Na.H/c4-1-3(5)2-9(6,7)8;;/h3,5H,1-2H2,(H,6,7,8);;/q;+1;-1 |
| InChIKey | UHAZNWILEWDBBY-UHFFFAOYSA-N |
| XLogP | -3.41 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.60 |
| LogP ≤ 5 | -3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|