C9H11NS — CID 173004165
4,5,5a,9a-tetrahydro-1,5-benzothiazepine (PubChem CID 173004165) has the molecular formula C9H11NS and a molecular weight of 165.26 g/mol. Its IUPAC name is 4,5,5a,9a-tetrahydro-1,5-benzothiazepine.
| Compound Name | 4,5,5a,9a-tetrahydro-1,5-benzothiazepine |
|---|---|
| PubChem CID | 173004165 |
| Molecular Formula | C9H11NS |
| Molecular Weight | 165.26 g/mol |
| Exact Mass | 165.06 |
| IUPAC Name | 4,5,5a,9a-tetrahydro-1,5-benzothiazepine |
| SMILES | C1=CC2NCC=CSC2C=C1 |
| InChI | InChI=1S/C9H11NS/c1-2-5-9-8(4-1)10-6-3-7-11-9/h1-5,7-10H,6H2 |
| InChIKey | AOUYEXRSVDOLKT-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.26 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |