C24H29NO5 — CID 173004603
(2S,5R)-1-tert-butyl-2-carboxy-2-methyl-5-(4-phenylmethoxyphenyl)pyrrolidin-1-ium-1-carboxylate (PubChem CID 173004603) has the molecular formula C24H29NO5 and a molecular weight of 411.50 g/mol. Its IUPAC name is (2S,5R)-1-tert-butyl-2-carboxy-2-methyl-5-(4-phenylmethoxyphenyl)pyrrolidin-1-ium-1-carboxylate.
| Compound Name | (2S,5R)-1-tert-butyl-2-carboxy-2-methyl-5-(4-phenylmethoxyphenyl)pyrrolidin-1-ium-1-carboxylate |
|---|---|
| PubChem CID | 173004603 |
| Molecular Formula | C24H29NO5 |
| Molecular Weight | 411.50 g/mol |
| Exact Mass | 411.20 |
| IUPAC Name | (2S,5R)-1-tert-butyl-2-carboxy-2-methyl-5-(4-phenylmethoxyphenyl)pyrrolidin-1-ium-1-carboxylate |
| SMILES | CC(C)(C)[N+]1(C(=O)[O-])[C@@H](c2ccc(OCc3ccccc3)cc2)CC[C@@]1(C)C(=O)O |
| InChI | InChI=1S/C24H29NO5/c1-23(2,3)25(22(28)29)20(14-15-24(25,4)21(26)27)18-10-12-19(13-11-18)30-16-17-8-6-5-7-9-17/h5-13,20H,14-16H2,1-4H3,(H-,26,27,28,29)/t20-,24+,25?/m1/s1 |
| InChIKey | DFEXCRYCNJZCHL-NNTPGIFBSA-N |
| XLogP | 3.90 |
| TPSA | 86.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.50 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|