selenido hydrogen selenite

HO3Se2- — CID 173004789

IUPACselenido hydrogen selenite
SMILESO=[Se](O)O[Se-]
InChIInChI=1S/H2O3Se2/c1-5(2)3-4/h4H,(H,1,2)/p-1
InChIKeyMZSBYIZAIYXWOY-UHFFFAOYSA-M
MW206.92 g/mol
LogP-1.51
Rot. Bonds1

About selenido hydrogen selenite

selenido hydrogen selenite (PubChem CID 173004789) has the molecular formula HO3Se2- and a molecular weight of 206.92 g/mol. Its IUPAC name is selenido hydrogen selenite.

Molecular Properties

Compound Nameselenido hydrogen selenite
PubChem CID173004789
Molecular FormulaHO3Se2-
Molecular Weight206.92 g/mol
Exact Mass208.83
IUPAC Nameselenido hydrogen selenite
SMILESO=[Se](O)O[Se-]
InChIInChI=1S/H2O3Se2/c1-5(2)3-4/h4H,(H,1,2)/p-1
InChIKeyMZSBYIZAIYXWOY-UHFFFAOYSA-M
XLogP-1.51
TPSA46.53 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds1
Heavy Atoms5
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500206.92
LogP ≤ 5-1.51
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'heavy_metal', 'substructure': 'N/A'}

Analyze selenido hydrogen selenite with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of selenido hydrogen selenite?
The IUPAC name of selenido hydrogen selenite (CID 173004789) is selenido hydrogen selenite.
What is the SMILES notation for selenido hydrogen selenite?
The canonical SMILES for selenido hydrogen selenite is O=[Se](O)O[Se-].
What is the InChIKey of selenido hydrogen selenite?
The InChIKey is MZSBYIZAIYXWOY-UHFFFAOYSA-M. The full InChI is InChI=1S/H2O3Se2/c1-5(2)3-4/h4H,(H,1,2)/p-1.
What are the key properties of selenido hydrogen selenite?
selenido hydrogen selenite has a molecular weight of 206.92 g/mol, XLogP of -1.51, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for selenido hydrogen selenite is sourced from PubChem (CID 173004789), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).