C20H16N2O — CID 173004863
3-phenyl-5-(4-phenylphenyl)-2,3-dihydro-1,2,4-oxadiazole (PubChem CID 173004863) has the molecular formula C20H16N2O and a molecular weight of 300.36 g/mol. Its IUPAC name is 3-phenyl-5-(4-phenylphenyl)-2,3-dihydro-1,2,4-oxadiazole.
| Compound Name | 3-phenyl-5-(4-phenylphenyl)-2,3-dihydro-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 173004863 |
| Molecular Formula | C20H16N2O |
| Molecular Weight | 300.36 g/mol |
| Exact Mass | 300.13 |
| IUPAC Name | 3-phenyl-5-(4-phenylphenyl)-2,3-dihydro-1,2,4-oxadiazole |
| SMILES | c1ccc(-c2ccc(C3=NC(c4ccccc4)NO3)cc2)cc1 |
| InChI | InChI=1S/C20H16N2O/c1-3-7-15(8-4-1)16-11-13-18(14-12-16)20-21-19(22-23-20)17-9-5-2-6-10-17/h1-14,19,22H |
| InChIKey | TWUBIBHGKAEIOJ-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 33.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.36 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |