C32H31Cl2N3O3 — CID 173005103
(3R,3'R,6'S)-6-chloro-3'-(5-chlorocyclohexa-2,4-dien-1-yl)-6'-[5-ethynyl-2-(1-methylpiperidin-4-yl)oxyphenyl]spiro[1H-indole-3,5'-piperidine]-2,2'-dione (PubChem CID 173005103) has the molecular formula C32H31Cl2N3O3 and a molecular weight of 576.52 g/mol. Its IUPAC name is (3R,3'R,6'S)-6-chloro-3'-(5-chlorocyclohexa-2,4-dien-1-yl)-6'-[5-ethynyl-2-(1-methylpiperidin-4-yl)oxyphenyl]spiro[1H-indole-3,5'-piperidine]-2,2'-dione.
| Compound Name | (3R,3'R,6'S)-6-chloro-3'-(5-chlorocyclohexa-2,4-dien-1-yl)-6'-[5-ethynyl-2-(1-methylpiperidin-4-yl)oxyphenyl]spiro[1H-indole-3,5'-piperidine]-2,2'-dione |
|---|---|
| PubChem CID | 173005103 |
| Molecular Formula | C32H31Cl2N3O3 |
| Molecular Weight | 576.52 g/mol |
| Exact Mass | 575.17 |
| IUPAC Name | (3R,3'R,6'S)-6-chloro-3'-(5-chlorocyclohexa-2,4-dien-1-yl)-6'-[5-ethynyl-2-(1-methylpiperidin-4-yl)oxyphenyl]spiro[1H-indole-3,5'-piperidine]-2,2'-dione |
| SMILES | C#Cc1ccc(OC2CCN(C)CC2)c([C@@H]2NC(=O)[C@@H](C3C=CC=C(Cl)C3)C[C@]23C(=O)Nc2cc(Cl)ccc23)c1 |
| InChI | InChI=1S/C32H31Cl2N3O3/c1-3-19-7-10-28(40-23-11-13-37(2)14-12-23)24(15-19)29-32(26-9-8-22(34)17-27(26)35-31(32)39)18-25(30(38)36-29)20-5-4-6-21(33)16-20/h1,4-10,15,17,20,23,25,29H,11-14,16,18H2,2H3,(H,35,39)(H,36,38)/t20?,25-,29+,32-/m1/s1 |
| InChIKey | QQJMMSDOKFZESK-TYHBMNLRSA-N |
| XLogP | 5.56 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.52 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|