C31H45NO3Si — CID 173005126
4-(1-diphenylsilyloxy-2,2-dimethylpropyl)-1-(5-hydroxycyclooctyl)-3,3-dimethylpyrrolidin-2-one (PubChem CID 173005126) has the molecular formula C31H45NO3Si and a molecular weight of 507.79 g/mol. Its IUPAC name is 4-(1-diphenylsilyloxy-2,2-dimethylpropyl)-1-(5-hydroxycyclooctyl)-3,3-dimethylpyrrolidin-2-one.
| Compound Name | 4-(1-diphenylsilyloxy-2,2-dimethylpropyl)-1-(5-hydroxycyclooctyl)-3,3-dimethylpyrrolidin-2-one |
|---|---|
| PubChem CID | 173005126 |
| Molecular Formula | C31H45NO3Si |
| Molecular Weight | 507.79 g/mol |
| Exact Mass | 507.32 |
| IUPAC Name | 4-(1-diphenylsilyloxy-2,2-dimethylpropyl)-1-(5-hydroxycyclooctyl)-3,3-dimethylpyrrolidin-2-one |
| SMILES | CC(C)(C)C(O[SiH](c1ccccc1)c1ccccc1)C1CN(C2CCCC(O)CCC2)C(=O)C1(C)C |
| InChI | InChI=1S/C31H45NO3Si/c1-30(2,3)28(35-36(25-18-8-6-9-19-25)26-20-10-7-11-21-26)27-22-32(29(34)31(27,4)5)23-14-12-16-24(33)17-13-15-23/h6-11,18-21,23-24,27-28,33,36H,12-17,22H2,1-5H3 |
| InChIKey | VODSYANJNNHAGR-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.79 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|