C6H7Cl6Na — CID 173006029
sodium;1,2,3,4,5,6-hexachlorocyclohexane;hydride (PubChem CID 173006029) has the molecular formula C6H7Cl6Na and a molecular weight of 314.83 g/mol. Its IUPAC name is sodium;1,2,3,4,5,6-hexachlorocyclohexane;hydride.
| Compound Name | sodium;1,2,3,4,5,6-hexachlorocyclohexane;hydride |
|---|---|
| PubChem CID | 173006029 |
| Molecular Formula | C6H7Cl6Na |
| Molecular Weight | 314.83 g/mol |
| Exact Mass | 311.86 |
| IUPAC Name | sodium;1,2,3,4,5,6-hexachlorocyclohexane;hydride |
| SMILES | ClC1C(Cl)C(Cl)C(Cl)C(Cl)C1Cl.[H-].[Na+] |
| InChI | InChI=1S/C6H6Cl6.Na.H/c7-1-2(8)4(10)6(12)5(11)3(1)9;;/h1-6H;;/q;+1;-1 |
| InChIKey | PQUAIQSJTVPZIG-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.83 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|