About 4-(aminodiazenyl)-N,5-dimethyl-1H-imidazole-2-carboxamide
4-(aminodiazenyl)-N,5-dimethyl-1H-imidazole-2-carboxamide (PubChem CID 173007869) has the molecular formula C6H10N6O
and a molecular weight of 182.19 g/mol. Its IUPAC name is 4-(aminodiazenyl)-N,5-dimethyl-1H-imidazole-2-carboxamide.
Molecular Properties
| Compound Name | 4-(aminodiazenyl)-N,5-dimethyl-1H-imidazole-2-carboxamide |
| PubChem CID | 173007869 |
| Molecular Formula | C6H10N6O |
| Molecular Weight | 182.19 g/mol |
| Exact Mass | 182.09 |
| IUPAC Name | 4-(aminodiazenyl)-N,5-dimethyl-1H-imidazole-2-carboxamide |
| SMILES | CNC(=O)c1nc(N=NN)c(C)[nH]1 |
| InChI | InChI=1S/C6H10N6O/c1-3-4(11-12-7)10-5(9-3)6(13)8-2/h1-2H3,(H2,7,11)(H,8,13)(H,9,10) |
| InChIKey | YPCSVGCVNBNECV-UHFFFAOYSA-N |
| XLogP | 0.04 |
| TPSA | 108.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.19 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-(aminodiazenyl)-N,5-dimethyl-1H-imidazole-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(aminodiazenyl)-N,5-dimethyl-1H-imidazole-2-carboxamide?
The IUPAC name of 4-(aminodiazenyl)-N,5-dimethyl-1H-imidazole-2-carboxamide (CID 173007869) is 4-(aminodiazenyl)-N,5-dimethyl-1H-imidazole-2-carboxamide.
What is the SMILES notation for 4-(aminodiazenyl)-N,5-dimethyl-1H-imidazole-2-carboxamide?
The canonical SMILES for 4-(aminodiazenyl)-N,5-dimethyl-1H-imidazole-2-carboxamide is CNC(=O)c1nc(N=NN)c(C)[nH]1.
What is the InChIKey of 4-(aminodiazenyl)-N,5-dimethyl-1H-imidazole-2-carboxamide?
The InChIKey is YPCSVGCVNBNECV-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10N6O/c1-3-4(11-12-7)10-5(9-3)6(13)8-2/h1-2H3,(H2,7,11)(H,8,13)(H,9,10).
What are the key properties of 4-(aminodiazenyl)-N,5-dimethyl-1H-imidazole-2-carboxamide?
4-(aminodiazenyl)-N,5-dimethyl-1H-imidazole-2-carboxamide has a molecular weight of 182.19 g/mol, XLogP of 0.04, 2 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(aminodiazenyl)-N,5-dimethyl-1H-imidazole-2-carboxamide is sourced from PubChem (CID 173007869), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).