About 3,3-dibutyloxadisilinane
3,3-dibutyloxadisilinane (PubChem CID 173008109) has the molecular formula C11H26OSi2
and a molecular weight of 230.50 g/mol. Its IUPAC name is 3,3-dibutyloxadisilinane.
Molecular Properties
| Compound Name | 3,3-dibutyloxadisilinane |
| PubChem CID | 173008109 |
| Molecular Formula | C11H26OSi2 |
| Molecular Weight | 230.50 g/mol |
| Exact Mass | 230.15 |
| IUPAC Name | 3,3-dibutyloxadisilinane |
| SMILES | CCCC[Si]1(CCCC)CCCO[SiH2]1 |
| InChI | InChI=1S/C11H26OSi2/c1-3-5-9-14(10-6-4-2)11-7-8-12-13-14/h3-11,13H2,1-2H3 |
| InChIKey | JRNURNZDNNJSJE-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.50 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 3,3-dibutyloxadisilinane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,3-dibutyloxadisilinane?
The IUPAC name of 3,3-dibutyloxadisilinane (CID 173008109) is 3,3-dibutyloxadisilinane.
What is the SMILES notation for 3,3-dibutyloxadisilinane?
The canonical SMILES for 3,3-dibutyloxadisilinane is CCCC[Si]1(CCCC)CCCO[SiH2]1.
What is the InChIKey of 3,3-dibutyloxadisilinane?
The InChIKey is JRNURNZDNNJSJE-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H26OSi2/c1-3-5-9-14(10-6-4-2)11-7-8-12-13-14/h3-11,13H2,1-2H3.
What are the key properties of 3,3-dibutyloxadisilinane?
3,3-dibutyloxadisilinane has a molecular weight of 230.50 g/mol, XLogP of 3.04, 6 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3,3-dibutyloxadisilinane is sourced from PubChem (CID 173008109), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).