About CID 173008905
CID 173008905 (PubChem CID 173008905) has the molecular formula H9O3Si4
and a molecular weight of 169.41 g/mol.
Molecular Properties
| Compound Name | CID 173008905 |
| PubChem CID | 173008905 |
| Molecular Formula | H9O3Si4 |
| Molecular Weight | 169.41 g/mol |
| Exact Mass | 168.96 |
| IUPAC Name | — |
| SMILES | [SiH2]O[SiH2]O[SiH2]O[SiH3] |
| InChI | InChI=1S/H9O3Si4/c4-1-6-3-7-2-5/h4,6-7H2,5H3 |
| InChIKey | YPLCYCVWLFTWOM-UHFFFAOYSA-N |
| XLogP | -4.14 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 169.41 |
| LogP ≤ 5 | -4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 173008905 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 173008905?
The IUPAC name of CID 173008905 (CID 173008905) is not available.
What is the SMILES notation for CID 173008905?
The canonical SMILES for CID 173008905 is [SiH2]O[SiH2]O[SiH2]O[SiH3].
What is the InChIKey of CID 173008905?
The InChIKey is YPLCYCVWLFTWOM-UHFFFAOYSA-N. The full InChI is InChI=1S/H9O3Si4/c4-1-6-3-7-2-5/h4,6-7H2,5H3.
What are the key properties of CID 173008905?
CID 173008905 has a molecular weight of 169.41 g/mol, XLogP of -4.14, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 173008905 is sourced from PubChem (CID 173008905), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).