About 1-iodo-1,4-dihydronaphthalene
1-iodo-1,4-dihydronaphthalene (PubChem CID 173009204) has the molecular formula C10H9I
and a molecular weight of 256.09 g/mol. Its IUPAC name is 1-iodo-1,4-dihydronaphthalene.
Molecular Properties
| Compound Name | 1-iodo-1,4-dihydronaphthalene |
| PubChem CID | 173009204 |
| Molecular Formula | C10H9I |
| Molecular Weight | 256.09 g/mol |
| Exact Mass | 255.97 |
| IUPAC Name | 1-iodo-1,4-dihydronaphthalene |
| SMILES | IC1C=CCc2ccccc21 |
| InChI | InChI=1S/C10H9I/c11-10-7-3-5-8-4-1-2-6-9(8)10/h1-4,6-7,10H,5H2 |
| InChIKey | UNSIPYABVRZKQC-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.09 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-iodo-1,4-dihydronaphthalene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-iodo-1,4-dihydronaphthalene?
The IUPAC name of 1-iodo-1,4-dihydronaphthalene (CID 173009204) is 1-iodo-1,4-dihydronaphthalene.
What is the SMILES notation for 1-iodo-1,4-dihydronaphthalene?
The canonical SMILES for 1-iodo-1,4-dihydronaphthalene is IC1C=CCc2ccccc21.
What is the InChIKey of 1-iodo-1,4-dihydronaphthalene?
The InChIKey is UNSIPYABVRZKQC-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9I/c11-10-7-3-5-8-4-1-2-6-9(8)10/h1-4,6-7,10H,5H2.
What are the key properties of 1-iodo-1,4-dihydronaphthalene?
1-iodo-1,4-dihydronaphthalene has a molecular weight of 256.09 g/mol, XLogP of 3.28, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-iodo-1,4-dihydronaphthalene is sourced from PubChem (CID 173009204), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).