About dimethyl-(2-methylhexa-2,5-dienoylamino)-propylazanium
dimethyl-(2-methylhexa-2,5-dienoylamino)-propylazanium (PubChem CID 173009466) has the molecular formula C12H23N2O+
and a molecular weight of 211.33 g/mol. Its IUPAC name is dimethyl-(2-methylhexa-2,5-dienoylamino)-propylazanium.
Molecular Properties
| Compound Name | dimethyl-(2-methylhexa-2,5-dienoylamino)-propylazanium |
| PubChem CID | 173009466 |
| Molecular Formula | C12H23N2O+ |
| Molecular Weight | 211.33 g/mol |
| Exact Mass | 211.18 |
| IUPAC Name | dimethyl-(2-methylhexa-2,5-dienoylamino)-propylazanium |
| SMILES | C=CCC=C(C)C(=O)N[N+](C)(C)CCC |
| InChI | InChI=1S/C12H22N2O/c1-6-8-9-11(3)12(15)13-14(4,5)10-7-2/h6,9H,1,7-8,10H2,2-5H3/p+1 |
| InChIKey | YWMJHOLDRVFWLY-UHFFFAOYSA-O |
| XLogP | 2.03 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.33 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze dimethyl-(2-methylhexa-2,5-dienoylamino)-propylazanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethyl-(2-methylhexa-2,5-dienoylamino)-propylazanium?
The IUPAC name of dimethyl-(2-methylhexa-2,5-dienoylamino)-propylazanium (CID 173009466) is dimethyl-(2-methylhexa-2,5-dienoylamino)-propylazanium.
What is the SMILES notation for dimethyl-(2-methylhexa-2,5-dienoylamino)-propylazanium?
The canonical SMILES for dimethyl-(2-methylhexa-2,5-dienoylamino)-propylazanium is C=CCC=C(C)C(=O)N[N+](C)(C)CCC.
What is the InChIKey of dimethyl-(2-methylhexa-2,5-dienoylamino)-propylazanium?
The InChIKey is YWMJHOLDRVFWLY-UHFFFAOYSA-O. The full InChI is InChI=1S/C12H22N2O/c1-6-8-9-11(3)12(15)13-14(4,5)10-7-2/h6,9H,1,7-8,10H2,2-5H3/p+1.
What are the key properties of dimethyl-(2-methylhexa-2,5-dienoylamino)-propylazanium?
dimethyl-(2-methylhexa-2,5-dienoylamino)-propylazanium has a molecular weight of 211.33 g/mol, XLogP of 2.03, 6 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for dimethyl-(2-methylhexa-2,5-dienoylamino)-propylazanium is sourced from PubChem (CID 173009466), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).