C44H33GaN4 — CID 173010365
gallane;2,3,5,7-tetraphenyl-21,23-dihydroporphyrin (PubChem CID 173010365) has the molecular formula C44H33GaN4 and a molecular weight of 687.50 g/mol. Its IUPAC name is gallane;2,3,5,7-tetraphenyl-21,23-dihydroporphyrin.
| Compound Name | gallane;2,3,5,7-tetraphenyl-21,23-dihydroporphyrin |
|---|---|
| PubChem CID | 173010365 |
| Molecular Formula | C44H33GaN4 |
| Molecular Weight | 687.50 g/mol |
| Exact Mass | 686.20 |
| IUPAC Name | gallane;2,3,5,7-tetraphenyl-21,23-dihydroporphyrin |
| SMILES | C1=Cc2cc3[nH]c(c(-c4ccccc4)c4nc(cc5ccc(cc1n2)[nH]5)C=C4c1ccccc1)c(-c1ccccc1)c3-c1ccccc1.[GaH3] |
| InChI | InChI=1S/C44H30N4.Ga.3H/c1-5-13-29(14-6-1)38-27-37-26-35-22-21-33(45-35)25-34-23-24-36(46-34)28-39-40(30-15-7-2-8-16-30)41(31-17-9-3-10-18-31)44(48-39)42(43(38)47-37)32-19-11-4-12-20-32;;;;/h1-28,45,48H;;;;/b33-25-,34-25-,35-26-,36-28-,37-26-,39-28-,43-42-,44-42-;;;; |
| InChIKey | BHRRJLIMIYXXGN-UGECTPNSSA-N |
| XLogP | 9.89 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 687.50 |
| LogP ≤ 5 | 9.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |