About 4-(dimethylaminodiazenyl)-1H-imidazole-5-carboxamide;5-fluoro-1H-pyrimidine-2,4-dione
4-(dimethylaminodiazenyl)-1H-imidazole-5-carboxamide;5-fluoro-1H-pyrimidine-2,4-dione (PubChem CID 173010993) has the molecular formula C10H13FN8O3
and a molecular weight of 312.27 g/mol. Its IUPAC name is 4-(dimethylaminodiazenyl)-1H-imidazole-5-carboxamide;5-fluoro-1H-pyrimidine-2,4-dione.
Molecular Properties
| Compound Name | 4-(dimethylaminodiazenyl)-1H-imidazole-5-carboxamide;5-fluoro-1H-pyrimidine-2,4-dione |
| PubChem CID | 173010993 |
| Molecular Formula | C10H13FN8O3 |
| Molecular Weight | 312.27 g/mol |
| Exact Mass | 312.11 |
| IUPAC Name | 4-(dimethylaminodiazenyl)-1H-imidazole-5-carboxamide;5-fluoro-1H-pyrimidine-2,4-dione |
| SMILES | CN(C)N=Nc1nc[nH]c1C(N)=O.O=c1[nH]cc(F)c(=O)[nH]1 |
| InChI | InChI=1S/C6H10N6O.C4H3FN2O2/c1-12(2)11-10-6-4(5(7)13)8-3-9-6;5-2-1-6-4(9)7-3(2)8/h3H,1-2H3,(H2,7,13)(H,8,9);1H,(H2,6,7,8,9) |
| InChIKey | RSYLWAAPOQCTBJ-UHFFFAOYSA-N |
| XLogP | -0.73 |
| TPSA | 165.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 312.27 |
| LogP ≤ 5 | -0.73 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-(dimethylaminodiazenyl)-1H-imidazole-5-carboxamide;5-fluoro-1H-pyrimidine-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(dimethylaminodiazenyl)-1H-imidazole-5-carboxamide;5-fluoro-1H-pyrimidine-2,4-dione?
The IUPAC name of 4-(dimethylaminodiazenyl)-1H-imidazole-5-carboxamide;5-fluoro-1H-pyrimidine-2,4-dione (CID 173010993) is 4-(dimethylaminodiazenyl)-1H-imidazole-5-carboxamide;5-fluoro-1H-pyrimidine-2,4-dione.
What is the SMILES notation for 4-(dimethylaminodiazenyl)-1H-imidazole-5-carboxamide;5-fluoro-1H-pyrimidine-2,4-dione?
The canonical SMILES for 4-(dimethylaminodiazenyl)-1H-imidazole-5-carboxamide;5-fluoro-1H-pyrimidine-2,4-dione is CN(C)N=Nc1nc[nH]c1C(N)=O.O=c1[nH]cc(F)c(=O)[nH]1.
What is the InChIKey of 4-(dimethylaminodiazenyl)-1H-imidazole-5-carboxamide;5-fluoro-1H-pyrimidine-2,4-dione?
The InChIKey is RSYLWAAPOQCTBJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10N6O.C4H3FN2O2/c1-12(2)11-10-6-4(5(7)13)8-3-9-6;5-2-1-6-4(9)7-3(2)8/h3H,1-2H3,(H2,7,13)(H,8,9);1H,(H2,6,7,8,9).
What are the key properties of 4-(dimethylaminodiazenyl)-1H-imidazole-5-carboxamide;5-fluoro-1H-pyrimidine-2,4-dione?
4-(dimethylaminodiazenyl)-1H-imidazole-5-carboxamide;5-fluoro-1H-pyrimidine-2,4-dione has a molecular weight of 312.27 g/mol, XLogP of -0.73, 3 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(dimethylaminodiazenyl)-1H-imidazole-5-carboxamide;5-fluoro-1H-pyrimidine-2,4-dione is sourced from PubChem (CID 173010993), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).