About dicopper;2-hydroxycyclohepta-2,4,6-trien-1-one;disulfate
dicopper;2-hydroxycyclohepta-2,4,6-trien-1-one;disulfate (PubChem CID 173011128) has the molecular formula C7H6Cu2O10S2
and a molecular weight of 441.34 g/mol. Its IUPAC name is dicopper;2-hydroxycyclohepta-2,4,6-trien-1-one;disulfate.
Molecular Properties
| Compound Name | dicopper;2-hydroxycyclohepta-2,4,6-trien-1-one;disulfate |
| PubChem CID | 173011128 |
| Molecular Formula | C7H6Cu2O10S2 |
| Molecular Weight | 441.34 g/mol |
| Exact Mass | 439.80 |
| IUPAC Name | dicopper;2-hydroxycyclohepta-2,4,6-trien-1-one;disulfate |
| SMILES | O=S(=O)([O-])[O-].O=S(=O)([O-])[O-].O=c1cccccc1O.[Cu+2].[Cu+2] |
| InChI | InChI=1S/C7H6O2.2Cu.2H2O4S/c8-6-4-2-1-3-5-7(6)9;;;2*1-5(2,3)4/h1-5H,(H,8,9);;;2*(H2,1,2,3,4)/q;2*+2;;/p-4 |
| InChIKey | VIYCKKLLSUITFC-UHFFFAOYSA-J |
| XLogP | -1.93 |
| TPSA | 197.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 441.34 |
| LogP ≤ 5 | -1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|
Analyze dicopper;2-hydroxycyclohepta-2,4,6-trien-1-one;disulfate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dicopper;2-hydroxycyclohepta-2,4,6-trien-1-one;disulfate?
The IUPAC name of dicopper;2-hydroxycyclohepta-2,4,6-trien-1-one;disulfate (CID 173011128) is dicopper;2-hydroxycyclohepta-2,4,6-trien-1-one;disulfate.
What is the SMILES notation for dicopper;2-hydroxycyclohepta-2,4,6-trien-1-one;disulfate?
The canonical SMILES for dicopper;2-hydroxycyclohepta-2,4,6-trien-1-one;disulfate is O=S(=O)([O-])[O-].O=S(=O)([O-])[O-].O=c1cccccc1O.[Cu+2].[Cu+2].
What is the InChIKey of dicopper;2-hydroxycyclohepta-2,4,6-trien-1-one;disulfate?
The InChIKey is VIYCKKLLSUITFC-UHFFFAOYSA-J. The full InChI is InChI=1S/C7H6O2.2Cu.2H2O4S/c8-6-4-2-1-3-5-7(6)9;;;2*1-5(2,3)4/h1-5H,(H,8,9);;;2*(H2,1,2,3,4)/q;2*+2;;/p-4.
What are the key properties of dicopper;2-hydroxycyclohepta-2,4,6-trien-1-one;disulfate?
dicopper;2-hydroxycyclohepta-2,4,6-trien-1-one;disulfate has a molecular weight of 441.34 g/mol, XLogP of -1.93, 0 rotatable bonds, 1 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for dicopper;2-hydroxycyclohepta-2,4,6-trien-1-one;disulfate is sourced from PubChem (CID 173011128), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).