About trisodium;carbonic acid;hydride
trisodium;carbonic acid;hydride (PubChem CID 173012363) has the molecular formula CH5Na3O3
and a molecular weight of 134.02 g/mol. Its IUPAC name is trisodium;carbonic acid;hydride.
Molecular Properties
| Compound Name | trisodium;carbonic acid;hydride |
| PubChem CID | 173012363 |
| Molecular Formula | CH5Na3O3 |
| Molecular Weight | 134.02 g/mol |
| Exact Mass | 133.99 |
| IUPAC Name | trisodium;carbonic acid;hydride |
| SMILES | O=C(O)O.[H-].[H-].[H-].[Na+].[Na+].[Na+] |
| InChI | InChI=1S/CH2O3.3Na.3H/c2-1(3)4;;;;;;/h(H2,2,3,4);;;;;;/q;3*+1;3*-1 |
| InChIKey | CXZVJESUHVJADX-UHFFFAOYSA-N |
| XLogP | -8.43 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 134.02 |
| LogP ≤ 5 | -8.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze trisodium;carbonic acid;hydride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trisodium;carbonic acid;hydride?
The IUPAC name of trisodium;carbonic acid;hydride (CID 173012363) is trisodium;carbonic acid;hydride.
What is the SMILES notation for trisodium;carbonic acid;hydride?
The canonical SMILES for trisodium;carbonic acid;hydride is O=C(O)O.[H-].[H-].[H-].[Na+].[Na+].[Na+].
What is the InChIKey of trisodium;carbonic acid;hydride?
The InChIKey is CXZVJESUHVJADX-UHFFFAOYSA-N. The full InChI is InChI=1S/CH2O3.3Na.3H/c2-1(3)4;;;;;;/h(H2,2,3,4);;;;;;/q;3*+1;3*-1.
What are the key properties of trisodium;carbonic acid;hydride?
trisodium;carbonic acid;hydride has a molecular weight of 134.02 g/mol, XLogP of -8.43, 0 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for trisodium;carbonic acid;hydride is sourced from PubChem (CID 173012363), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).