About azane;5-(phenothiazin-3-ylideneamino)benzene-1,3-dicarboxylic acid
azane;5-(phenothiazin-3-ylideneamino)benzene-1,3-dicarboxylic acid (PubChem CID 173012429) has the molecular formula C20H15N3O4S
and a molecular weight of 393.42 g/mol. Its IUPAC name is azane;5-(phenothiazin-3-ylideneamino)benzene-1,3-dicarboxylic acid.
Molecular Properties
| Compound Name | azane;5-(phenothiazin-3-ylideneamino)benzene-1,3-dicarboxylic acid |
| PubChem CID | 173012429 |
| Molecular Formula | C20H15N3O4S |
| Molecular Weight | 393.42 g/mol |
| Exact Mass | 393.08 |
| IUPAC Name | azane;5-(phenothiazin-3-ylideneamino)benzene-1,3-dicarboxylic acid |
| SMILES | N.O=C(O)c1cc(/N=c2\ccc3nc4ccccc4sc-3c2)cc(C(=O)O)c1 |
| InChI | InChI=1S/C20H12N2O4S.H3N/c23-19(24)11-7-12(20(25)26)9-14(8-11)21-13-5-6-16-18(10-13)27-17-4-2-1-3-15(17)22-16;/h1-10H,(H,23,24)(H,25,26);1H3/b21-13+; |
| InChIKey | OVHMNBDWISAPSD-PGCULMPHSA-N |
| XLogP | 4.19 |
| TPSA | 134.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 393.42 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze azane;5-(phenothiazin-3-ylideneamino)benzene-1,3-dicarboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;5-(phenothiazin-3-ylideneamino)benzene-1,3-dicarboxylic acid?
The IUPAC name of azane;5-(phenothiazin-3-ylideneamino)benzene-1,3-dicarboxylic acid (CID 173012429) is azane;5-(phenothiazin-3-ylideneamino)benzene-1,3-dicarboxylic acid.
What is the SMILES notation for azane;5-(phenothiazin-3-ylideneamino)benzene-1,3-dicarboxylic acid?
The canonical SMILES for azane;5-(phenothiazin-3-ylideneamino)benzene-1,3-dicarboxylic acid is N.O=C(O)c1cc(/N=c2\ccc3nc4ccccc4sc-3c2)cc(C(=O)O)c1.
What is the InChIKey of azane;5-(phenothiazin-3-ylideneamino)benzene-1,3-dicarboxylic acid?
The InChIKey is OVHMNBDWISAPSD-PGCULMPHSA-N. The full InChI is InChI=1S/C20H12N2O4S.H3N/c23-19(24)11-7-12(20(25)26)9-14(8-11)21-13-5-6-16-18(10-13)27-17-4-2-1-3-15(17)22-16;/h1-10H,(H,23,24)(H,25,26);1H3/b21-13+;.
What are the key properties of azane;5-(phenothiazin-3-ylideneamino)benzene-1,3-dicarboxylic acid?
azane;5-(phenothiazin-3-ylideneamino)benzene-1,3-dicarboxylic acid has a molecular weight of 393.42 g/mol, XLogP of 4.19, 3 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for azane;5-(phenothiazin-3-ylideneamino)benzene-1,3-dicarboxylic acid is sourced from PubChem (CID 173012429), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).