About sodium;2,3-bis(2-methylpropyl)-2-sulfobutanedioic acid;hydride
sodium;2,3-bis(2-methylpropyl)-2-sulfobutanedioic acid;hydride (PubChem CID 173013168) has the molecular formula C12H23NaO7S
and a molecular weight of 334.37 g/mol. Its IUPAC name is sodium;2,3-bis(2-methylpropyl)-2-sulfobutanedioic acid;hydride.
Molecular Properties
| Compound Name | sodium;2,3-bis(2-methylpropyl)-2-sulfobutanedioic acid;hydride |
| PubChem CID | 173013168 |
| Molecular Formula | C12H23NaO7S |
| Molecular Weight | 334.37 g/mol |
| Exact Mass | 334.11 |
| IUPAC Name | sodium;2,3-bis(2-methylpropyl)-2-sulfobutanedioic acid;hydride |
| SMILES | CC(C)CC(C(=O)O)C(CC(C)C)(C(=O)O)S(=O)(=O)O.[H-].[Na+] |
| InChI | InChI=1S/C12H22O7S.Na.H/c1-7(2)5-9(10(13)14)12(11(15)16,6-8(3)4)20(17,18)19;;/h7-9H,5-6H2,1-4H3,(H,13,14)(H,15,16)(H,17,18,19);;/q;+1;-1 |
| InChIKey | NILBTDIGSGJCDV-UHFFFAOYSA-N |
| XLogP | -1.39 |
| TPSA | 128.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 334.37 |
| LogP ≤ 5 | -1.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze sodium;2,3-bis(2-methylpropyl)-2-sulfobutanedioic acid;hydride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;2,3-bis(2-methylpropyl)-2-sulfobutanedioic acid;hydride?
The IUPAC name of sodium;2,3-bis(2-methylpropyl)-2-sulfobutanedioic acid;hydride (CID 173013168) is sodium;2,3-bis(2-methylpropyl)-2-sulfobutanedioic acid;hydride.
What is the SMILES notation for sodium;2,3-bis(2-methylpropyl)-2-sulfobutanedioic acid;hydride?
The canonical SMILES for sodium;2,3-bis(2-methylpropyl)-2-sulfobutanedioic acid;hydride is CC(C)CC(C(=O)O)C(CC(C)C)(C(=O)O)S(=O)(=O)O.[H-].[Na+].
What is the InChIKey of sodium;2,3-bis(2-methylpropyl)-2-sulfobutanedioic acid;hydride?
The InChIKey is NILBTDIGSGJCDV-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22O7S.Na.H/c1-7(2)5-9(10(13)14)12(11(15)16,6-8(3)4)20(17,18)19;;/h7-9H,5-6H2,1-4H3,(H,13,14)(H,15,16)(H,17,18,19);;/q;+1;-1.
What are the key properties of sodium;2,3-bis(2-methylpropyl)-2-sulfobutanedioic acid;hydride?
sodium;2,3-bis(2-methylpropyl)-2-sulfobutanedioic acid;hydride has a molecular weight of 334.37 g/mol, XLogP of -1.39, 8 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;2,3-bis(2-methylpropyl)-2-sulfobutanedioic acid;hydride is sourced from PubChem (CID 173013168), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).