About 2-aminopyrrolo[2,3-d]pyrimidin-3-ium-4-one
2-aminopyrrolo[2,3-d]pyrimidin-3-ium-4-one (PubChem CID 173013525) has the molecular formula C6H5N4O+
and a molecular weight of 149.13 g/mol. Its IUPAC name is 2-aminopyrrolo[2,3-d]pyrimidin-3-ium-4-one.
Molecular Properties
| Compound Name | 2-aminopyrrolo[2,3-d]pyrimidin-3-ium-4-one |
| PubChem CID | 173013525 |
| Molecular Formula | C6H5N4O+ |
| Molecular Weight | 149.13 g/mol |
| Exact Mass | 149.05 |
| IUPAC Name | 2-aminopyrrolo[2,3-d]pyrimidin-3-ium-4-one |
| SMILES | NC1=[NH+]C(=O)C2=CC=NC2=N1 |
| InChI | InChI=1S/C6H4N4O/c7-6-9-4-3(1-2-8-4)5(11)10-6/h1-2H,(H2,7,10,11)/p+1 |
| InChIKey | IOQWCZKWYJSIPY-UHFFFAOYSA-O |
| XLogP | -2.67 |
| TPSA | 81.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 149.13 |
| LogP ≤ 5 | -2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-aminopyrrolo[2,3-d]pyrimidin-3-ium-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-aminopyrrolo[2,3-d]pyrimidin-3-ium-4-one?
The IUPAC name of 2-aminopyrrolo[2,3-d]pyrimidin-3-ium-4-one (CID 173013525) is 2-aminopyrrolo[2,3-d]pyrimidin-3-ium-4-one.
What is the SMILES notation for 2-aminopyrrolo[2,3-d]pyrimidin-3-ium-4-one?
The canonical SMILES for 2-aminopyrrolo[2,3-d]pyrimidin-3-ium-4-one is NC1=[NH+]C(=O)C2=CC=NC2=N1.
What is the InChIKey of 2-aminopyrrolo[2,3-d]pyrimidin-3-ium-4-one?
The InChIKey is IOQWCZKWYJSIPY-UHFFFAOYSA-O. The full InChI is InChI=1S/C6H4N4O/c7-6-9-4-3(1-2-8-4)5(11)10-6/h1-2H,(H2,7,10,11)/p+1.
What are the key properties of 2-aminopyrrolo[2,3-d]pyrimidin-3-ium-4-one?
2-aminopyrrolo[2,3-d]pyrimidin-3-ium-4-one has a molecular weight of 149.13 g/mol, XLogP of -2.67, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-aminopyrrolo[2,3-d]pyrimidin-3-ium-4-one is sourced from PubChem (CID 173013525), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).