C15H26ClN — CID 173013560
(2,3,4,5-tetraethylphenyl)methanamine;hydrochloride (PubChem CID 173013560) has the molecular formula C15H26ClN and a molecular weight of 255.83 g/mol. Its IUPAC name is (2,3,4,5-tetraethylphenyl)methanamine;hydrochloride.
| Compound Name | (2,3,4,5-tetraethylphenyl)methanamine;hydrochloride |
|---|---|
| PubChem CID | 173013560 |
| Molecular Formula | C15H26ClN |
| Molecular Weight | 255.83 g/mol |
| Exact Mass | 255.18 |
| IUPAC Name | (2,3,4,5-tetraethylphenyl)methanamine;hydrochloride |
| SMILES | CCc1cc(CN)c(CC)c(CC)c1CC.Cl |
| InChI | InChI=1S/C15H25N.ClH/c1-5-11-9-12(10-16)14(7-3)15(8-4)13(11)6-2;/h9H,5-8,10,16H2,1-4H3;1H |
| InChIKey | JFWSPVLGUIPOKC-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.83 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |