About triethoxysilane;1,1,2-trifluorocyclopropane
triethoxysilane;1,1,2-trifluorocyclopropane (PubChem CID 173013608) has the molecular formula C9H19F3O3Si
and a molecular weight of 260.33 g/mol. Its IUPAC name is triethoxysilane;1,1,2-trifluorocyclopropane.
Molecular Properties
| Compound Name | triethoxysilane;1,1,2-trifluorocyclopropane |
| PubChem CID | 173013608 |
| Molecular Formula | C9H19F3O3Si |
| Molecular Weight | 260.33 g/mol |
| Exact Mass | 260.11 |
| IUPAC Name | triethoxysilane;1,1,2-trifluorocyclopropane |
| SMILES | CCO[SiH](OCC)OCC.FC1CC1(F)F |
| InChI | InChI=1S/C6H16O3Si.C3H3F3/c1-4-7-10(8-5-2)9-6-3;4-2-1-3(2,5)6/h10H,4-6H2,1-3H3;2H,1H2 |
| InChIKey | GRUFMOWAFTVPST-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.33 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze triethoxysilane;1,1,2-trifluorocyclopropane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of triethoxysilane;1,1,2-trifluorocyclopropane?
The IUPAC name of triethoxysilane;1,1,2-trifluorocyclopropane (CID 173013608) is triethoxysilane;1,1,2-trifluorocyclopropane.
What is the SMILES notation for triethoxysilane;1,1,2-trifluorocyclopropane?
The canonical SMILES for triethoxysilane;1,1,2-trifluorocyclopropane is CCO[SiH](OCC)OCC.FC1CC1(F)F.
What is the InChIKey of triethoxysilane;1,1,2-trifluorocyclopropane?
The InChIKey is GRUFMOWAFTVPST-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H16O3Si.C3H3F3/c1-4-7-10(8-5-2)9-6-3;4-2-1-3(2,5)6/h10H,4-6H2,1-3H3;2H,1H2.
What are the key properties of triethoxysilane;1,1,2-trifluorocyclopropane?
triethoxysilane;1,1,2-trifluorocyclopropane has a molecular weight of 260.33 g/mol, XLogP of 2.18, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for triethoxysilane;1,1,2-trifluorocyclopropane is sourced from PubChem (CID 173013608), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).