potassium;hydride;2-(3-methoxycyclopentyl)acetic acid

C8H15KO3 — CID 173013744

IUPACpotassium;hydride;2-(3-methoxycyclopentyl)acetic acid
SMILESCOC1CCC(CC(=O)O)C1.[H-].[K+]
InChIInChI=1S/C8H14O3.K.H/c1-11-7-3-2-6(4-7)5-8(9)10;;/h6-7H,2-5H2,1H3,(H,9,10);;/q;+1;-1
InChIKeyIJMLVPQIYSDDLQ-UHFFFAOYSA-N
MW198.30 g/mol
LogP-1.61
Rot. Bonds3

About potassium;hydride;2-(3-methoxycyclopentyl)acetic acid

potassium;hydride;2-(3-methoxycyclopentyl)acetic acid (PubChem CID 173013744) has the molecular formula C8H15KO3 and a molecular weight of 198.30 g/mol. Its IUPAC name is potassium;hydride;2-(3-methoxycyclopentyl)acetic acid.

Molecular Properties

Compound Namepotassium;hydride;2-(3-methoxycyclopentyl)acetic acid
PubChem CID173013744
Molecular FormulaC8H15KO3
Molecular Weight198.30 g/mol
Exact Mass198.07
IUPAC Namepotassium;hydride;2-(3-methoxycyclopentyl)acetic acid
SMILESCOC1CCC(CC(=O)O)C1.[H-].[K+]
InChIInChI=1S/C8H14O3.K.H/c1-11-7-3-2-6(4-7)5-8(9)10;;/h6-7H,2-5H2,1H3,(H,9,10);;/q;+1;-1
InChIKeyIJMLVPQIYSDDLQ-UHFFFAOYSA-N
XLogP-1.61
TPSA46.53 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds3
Heavy Atoms12
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500198.30
LogP ≤ 5-1.61
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze potassium;hydride;2-(3-methoxycyclopentyl)acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of potassium;hydride;2-(3-methoxycyclopentyl)acetic acid?
The IUPAC name of potassium;hydride;2-(3-methoxycyclopentyl)acetic acid (CID 173013744) is potassium;hydride;2-(3-methoxycyclopentyl)acetic acid.
What is the SMILES notation for potassium;hydride;2-(3-methoxycyclopentyl)acetic acid?
The canonical SMILES for potassium;hydride;2-(3-methoxycyclopentyl)acetic acid is COC1CCC(CC(=O)O)C1.[H-].[K+].
What is the InChIKey of potassium;hydride;2-(3-methoxycyclopentyl)acetic acid?
The InChIKey is IJMLVPQIYSDDLQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14O3.K.H/c1-11-7-3-2-6(4-7)5-8(9)10;;/h6-7H,2-5H2,1H3,(H,9,10);;/q;+1;-1.
What are the key properties of potassium;hydride;2-(3-methoxycyclopentyl)acetic acid?
potassium;hydride;2-(3-methoxycyclopentyl)acetic acid has a molecular weight of 198.30 g/mol, XLogP of -1.61, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for potassium;hydride;2-(3-methoxycyclopentyl)acetic acid is sourced from PubChem (CID 173013744), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).