About 1-butylpyrrolidine;diethoxysilane
1-butylpyrrolidine;diethoxysilane (PubChem CID 173014045) has the molecular formula C12H29NO2Si
and a molecular weight of 247.45 g/mol. Its IUPAC name is 1-butylpyrrolidine;diethoxysilane.
Molecular Properties
| Compound Name | 1-butylpyrrolidine;diethoxysilane |
| PubChem CID | 173014045 |
| Molecular Formula | C12H29NO2Si |
| Molecular Weight | 247.45 g/mol |
| Exact Mass | 247.20 |
| IUPAC Name | 1-butylpyrrolidine;diethoxysilane |
| SMILES | CCCCN1CCCC1.CCO[SiH2]OCC |
| InChI | InChI=1S/C8H17N.C4H12O2Si/c1-2-3-6-9-7-4-5-8-9;1-3-5-7-6-4-2/h2-8H2,1H3;3-4,7H2,1-2H3 |
| InChIKey | DRBYLJNPZFEADU-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.45 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 1-butylpyrrolidine;diethoxysilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-butylpyrrolidine;diethoxysilane?
The IUPAC name of 1-butylpyrrolidine;diethoxysilane (CID 173014045) is 1-butylpyrrolidine;diethoxysilane.
What is the SMILES notation for 1-butylpyrrolidine;diethoxysilane?
The canonical SMILES for 1-butylpyrrolidine;diethoxysilane is CCCCN1CCCC1.CCO[SiH2]OCC.
What is the InChIKey of 1-butylpyrrolidine;diethoxysilane?
The InChIKey is DRBYLJNPZFEADU-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H17N.C4H12O2Si/c1-2-3-6-9-7-4-5-8-9;1-3-5-7-6-4-2/h2-8H2,1H3;3-4,7H2,1-2H3.
What are the key properties of 1-butylpyrrolidine;diethoxysilane?
1-butylpyrrolidine;diethoxysilane has a molecular weight of 247.45 g/mol, XLogP of 1.94, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-butylpyrrolidine;diethoxysilane is sourced from PubChem (CID 173014045), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).