C18H26N2O5 — CID 173014572
3-[4-[3-(oxan-4-ylamino)-3-oxopropyl]phenoxy]propyl carbamate (PubChem CID 173014572) has the molecular formula C18H26N2O5 and a molecular weight of 350.42 g/mol. Its IUPAC name is 3-[4-[3-(oxan-4-ylamino)-3-oxopropyl]phenoxy]propyl carbamate.
| Compound Name | 3-[4-[3-(oxan-4-ylamino)-3-oxopropyl]phenoxy]propyl carbamate |
|---|---|
| PubChem CID | 173014572 |
| Molecular Formula | C18H26N2O5 |
| Molecular Weight | 350.42 g/mol |
| Exact Mass | 350.18 |
| IUPAC Name | 3-[4-[3-(oxan-4-ylamino)-3-oxopropyl]phenoxy]propyl carbamate |
| SMILES | NC(=O)OCCCOc1ccc(CCC(=O)NC2CCOCC2)cc1 |
| InChI | InChI=1S/C18H26N2O5/c19-18(22)25-11-1-10-24-16-5-2-14(3-6-16)4-7-17(21)20-15-8-12-23-13-9-15/h2-3,5-6,15H,1,4,7-13H2,(H2,19,22)(H,20,21) |
| InChIKey | JJBXVIHXJSWMLU-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 99.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.42 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|