C20H20F3N5O3 — CID 173014592
1-[3-[7-(2-methoxyethoxyiminomethyl)imidazo[1,2-a]pyridin-3-yl]phenyl]-3-(1,2,2-trifluoroethyl)urea (PubChem CID 173014592) has the molecular formula C20H20F3N5O3 and a molecular weight of 435.41 g/mol. Its IUPAC name is 1-[3-[7-(2-methoxyethoxyiminomethyl)imidazo[1,2-a]pyridin-3-yl]phenyl]-3-(1,2,2-trifluoroethyl)urea.
| Compound Name | 1-[3-[7-(2-methoxyethoxyiminomethyl)imidazo[1,2-a]pyridin-3-yl]phenyl]-3-(1,2,2-trifluoroethyl)urea |
|---|---|
| PubChem CID | 173014592 |
| Molecular Formula | C20H20F3N5O3 |
| Molecular Weight | 435.41 g/mol |
| Exact Mass | 435.15 |
| IUPAC Name | 1-[3-[7-(2-methoxyethoxyiminomethyl)imidazo[1,2-a]pyridin-3-yl]phenyl]-3-(1,2,2-trifluoroethyl)urea |
| SMILES | COCCON=Cc1ccn2c(-c3cccc(NC(=O)NC(F)C(F)F)c3)cnc2c1 |
| InChI | InChI=1S/C20H20F3N5O3/c1-30-7-8-31-25-11-13-5-6-28-16(12-24-17(28)9-13)14-3-2-4-15(10-14)26-20(29)27-19(23)18(21)22/h2-6,9-12,18-19H,7-8H2,1H3,(H2,26,27,29) |
| InChIKey | HWDCGGQCRVPPFZ-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 89.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.41 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|