About sodium;1-[[4-(4-chlorophenoxy)-4-oxobutyl]carbamoyloxy]butyl cyclopentanecarboxylate;hydride
sodium;1-[[4-(4-chlorophenoxy)-4-oxobutyl]carbamoyloxy]butyl cyclopentanecarboxylate;hydride (PubChem CID 173014754) has the molecular formula C21H29ClNNaO6
and a molecular weight of 449.91 g/mol. Its IUPAC name is sodium;1-[[4-(4-chlorophenoxy)-4-oxobutyl]carbamoyloxy]butyl cyclopentanecarboxylate;hydride.
Molecular Properties
| Compound Name | sodium;1-[[4-(4-chlorophenoxy)-4-oxobutyl]carbamoyloxy]butyl cyclopentanecarboxylate;hydride |
| PubChem CID | 173014754 |
| Molecular Formula | C21H29ClNNaO6 |
| Molecular Weight | 449.91 g/mol |
| Exact Mass | 449.16 |
| IUPAC Name | sodium;1-[[4-(4-chlorophenoxy)-4-oxobutyl]carbamoyloxy]butyl cyclopentanecarboxylate;hydride |
| SMILES | CCCC(OC(=O)NCCCC(=O)Oc1ccc(Cl)cc1)OC(=O)C1CCCC1.[H-].[Na+] |
| InChI | InChI=1S/C21H28ClNO6.Na.H/c1-2-6-19(28-20(25)15-7-3-4-8-15)29-21(26)23-14-5-9-18(24)27-17-12-10-16(22)11-13-17;;/h10-13,15,19H,2-9,14H2,1H3,(H,23,26);;/q;+1;-1 |
| InChIKey | JWQLFININVUIPL-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 449.91 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze sodium;1-[[4-(4-chlorophenoxy)-4-oxobutyl]carbamoyloxy]butyl cyclopentanecarboxylate;hydride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;1-[[4-(4-chlorophenoxy)-4-oxobutyl]carbamoyloxy]butyl cyclopentanecarboxylate;hydride?
The IUPAC name of sodium;1-[[4-(4-chlorophenoxy)-4-oxobutyl]carbamoyloxy]butyl cyclopentanecarboxylate;hydride (CID 173014754) is sodium;1-[[4-(4-chlorophenoxy)-4-oxobutyl]carbamoyloxy]butyl cyclopentanecarboxylate;hydride.
What is the SMILES notation for sodium;1-[[4-(4-chlorophenoxy)-4-oxobutyl]carbamoyloxy]butyl cyclopentanecarboxylate;hydride?
The canonical SMILES for sodium;1-[[4-(4-chlorophenoxy)-4-oxobutyl]carbamoyloxy]butyl cyclopentanecarboxylate;hydride is CCCC(OC(=O)NCCCC(=O)Oc1ccc(Cl)cc1)OC(=O)C1CCCC1.[H-].[Na+].
What is the InChIKey of sodium;1-[[4-(4-chlorophenoxy)-4-oxobutyl]carbamoyloxy]butyl cyclopentanecarboxylate;hydride?
The InChIKey is JWQLFININVUIPL-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H28ClNO6.Na.H/c1-2-6-19(28-20(25)15-7-3-4-8-15)29-21(26)23-14-5-9-18(24)27-17-12-10-16(22)11-13-17;;/h10-13,15,19H,2-9,14H2,1H3,(H,23,26);;/q;+1;-1.
What are the key properties of sodium;1-[[4-(4-chlorophenoxy)-4-oxobutyl]carbamoyloxy]butyl cyclopentanecarboxylate;hydride?
sodium;1-[[4-(4-chlorophenoxy)-4-oxobutyl]carbamoyloxy]butyl cyclopentanecarboxylate;hydride has a molecular weight of 449.91 g/mol, XLogP of 1.73, 10 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;1-[[4-(4-chlorophenoxy)-4-oxobutyl]carbamoyloxy]butyl cyclopentanecarboxylate;hydride is sourced from PubChem (CID 173014754), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).