About CID 173015098
CID 173015098 (PubChem CID 173015098) has the molecular formula H4KO8S2
and a molecular weight of 235.26 g/mol.
Molecular Properties
| Compound Name | CID 173015098 |
| PubChem CID | 173015098 |
| Molecular Formula | H4KO8S2 |
| Molecular Weight | 235.26 g/mol |
| Exact Mass | 234.90 |
| IUPAC Name | — |
| SMILES | O=S(=O)(O)O.O=S(=O)(O)O.[K] |
| InChI | InChI=1S/K.2H2O4S/c;2*1-5(2,3)4/h;2*(H2,1,2,3,4) |
| InChIKey | ZSQFSVLAKLRQSE-UHFFFAOYSA-N |
| XLogP | -1.69 |
| TPSA | 149.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.26 |
| LogP ≤ 5 | -1.69 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze CID 173015098 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 173015098?
The IUPAC name of CID 173015098 (CID 173015098) is not available.
What is the SMILES notation for CID 173015098?
The canonical SMILES for CID 173015098 is O=S(=O)(O)O.O=S(=O)(O)O.[K].
What is the InChIKey of CID 173015098?
The InChIKey is ZSQFSVLAKLRQSE-UHFFFAOYSA-N. The full InChI is InChI=1S/K.2H2O4S/c;2*1-5(2,3)4/h;2*(H2,1,2,3,4).
What are the key properties of CID 173015098?
CID 173015098 has a molecular weight of 235.26 g/mol, XLogP of -1.69, 0 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 173015098 is sourced from PubChem (CID 173015098), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).