C10H16O2Si — CID 173015630
3-(2-dimethylsilyloxan-2-yl)propa-1,2-dien-1-one (PubChem CID 173015630) has the molecular formula C10H16O2Si and a molecular weight of 196.32 g/mol. Its IUPAC name is 3-(2-dimethylsilyloxan-2-yl)propa-1,2-dien-1-one.
| Compound Name | 3-(2-dimethylsilyloxan-2-yl)propa-1,2-dien-1-one |
|---|---|
| PubChem CID | 173015630 |
| Molecular Formula | C10H16O2Si |
| Molecular Weight | 196.32 g/mol |
| Exact Mass | 196.09 |
| IUPAC Name | 3-(2-dimethylsilyloxan-2-yl)propa-1,2-dien-1-one |
| SMILES | C[SiH](C)C1(C=C=C=O)CCCCO1 |
| InChI | InChI=1S/C10H16O2Si/c1-13(2)10(7-5-8-11)6-3-4-9-12-10/h7,13H,3-4,6,9H2,1-2H3 |
| InChIKey | JECTXXYVWPJUND-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.32 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'ketene', 'substructure': 'N/A'} |
|---|