About 1-cyclopropylethyl ethyl carbonate
1-cyclopropylethyl ethyl carbonate (PubChem CID 173016533) has the molecular formula C8H14O3
and a molecular weight of 158.20 g/mol. Its IUPAC name is 1-cyclopropylethyl ethyl carbonate.
Molecular Properties
| Compound Name | 1-cyclopropylethyl ethyl carbonate |
| PubChem CID | 173016533 |
| Molecular Formula | C8H14O3 |
| Molecular Weight | 158.20 g/mol |
| Exact Mass | 158.09 |
| IUPAC Name | 1-cyclopropylethyl ethyl carbonate |
| SMILES | CCOC(=O)OC(C)C1CC1 |
| InChI | InChI=1S/C8H14O3/c1-3-10-8(9)11-6(2)7-4-5-7/h6-7H,3-5H2,1-2H3 |
| InChIKey | NBDHXFGHDSMKLW-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.20 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-cyclopropylethyl ethyl carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclopropylethyl ethyl carbonate?
The IUPAC name of 1-cyclopropylethyl ethyl carbonate (CID 173016533) is 1-cyclopropylethyl ethyl carbonate.
What is the SMILES notation for 1-cyclopropylethyl ethyl carbonate?
The canonical SMILES for 1-cyclopropylethyl ethyl carbonate is CCOC(=O)OC(C)C1CC1.
What is the InChIKey of 1-cyclopropylethyl ethyl carbonate?
The InChIKey is NBDHXFGHDSMKLW-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14O3/c1-3-10-8(9)11-6(2)7-4-5-7/h6-7H,3-5H2,1-2H3.
What are the key properties of 1-cyclopropylethyl ethyl carbonate?
1-cyclopropylethyl ethyl carbonate has a molecular weight of 158.20 g/mol, XLogP of 1.96, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclopropylethyl ethyl carbonate is sourced from PubChem (CID 173016533), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).