C9H22N2OSi — CID 173017029
1-ethenylsilyl-1-ethoxy-N,N,N',N'-tetramethylmethanediamine (PubChem CID 173017029) has the molecular formula C9H22N2OSi and a molecular weight of 202.37 g/mol. Its IUPAC name is 1-ethenylsilyl-1-ethoxy-N,N,N',N'-tetramethylmethanediamine.
| Compound Name | 1-ethenylsilyl-1-ethoxy-N,N,N',N'-tetramethylmethanediamine |
|---|---|
| PubChem CID | 173017029 |
| Molecular Formula | C9H22N2OSi |
| Molecular Weight | 202.37 g/mol |
| Exact Mass | 202.15 |
| IUPAC Name | 1-ethenylsilyl-1-ethoxy-N,N,N',N'-tetramethylmethanediamine |
| SMILES | C=C[SiH2]C(OCC)(N(C)C)N(C)C |
| InChI | InChI=1S/C9H22N2OSi/c1-7-12-9(10(3)4,11(5)6)13-8-2/h8H,2,7,13H2,1,3-6H3 |
| InChIKey | HUVNGEUAYPSMPD-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.37 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|