C13H30N2Si — CID 173017031
3-N,3-N,3-N',3-N'-tetraethyl-2-silylpent-1-ene-3,3-diamine (PubChem CID 173017031) has the molecular formula C13H30N2Si and a molecular weight of 242.48 g/mol. Its IUPAC name is 3-N,3-N,3-N',3-N'-tetraethyl-2-silylpent-1-ene-3,3-diamine.
| Compound Name | 3-N,3-N,3-N',3-N'-tetraethyl-2-silylpent-1-ene-3,3-diamine |
|---|---|
| PubChem CID | 173017031 |
| Molecular Formula | C13H30N2Si |
| Molecular Weight | 242.48 g/mol |
| Exact Mass | 242.22 |
| IUPAC Name | 3-N,3-N,3-N',3-N'-tetraethyl-2-silylpent-1-ene-3,3-diamine |
| SMILES | C=C([SiH3])C(CC)(N(CC)CC)N(CC)CC |
| InChI | InChI=1S/C13H30N2Si/c1-7-13(12(6)16,14(8-2)9-3)15(10-4)11-5/h6-11H2,1-5,16H3 |
| InChIKey | BDBNFZFUKBPKNR-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.48 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|