C26H27N5O3S2 — CID 17301827
2-[[5-(3,4-dimethoxyphenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-N-[4-(3,4-dimethylphenyl)-1,3-thiazol-2-yl]acetamide (PubChem CID 17301827) has the molecular formula C26H27N5O3S2 and a molecular weight of 521.67 g/mol. Its IUPAC name is 2-[[5-(3,4-dimethoxyphenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-N-[4-(3,4-dimethylphenyl)-1,3-thiazol-2-yl]acetamide.
| Compound Name | 2-[[5-(3,4-dimethoxyphenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-N-[4-(3,4-dimethylphenyl)-1,3-thiazol-2-yl]acetamide |
|---|---|
| PubChem CID | 17301827 |
| Molecular Formula | C26H27N5O3S2 |
| Molecular Weight | 521.67 g/mol |
| Exact Mass | 521.16 |
| IUPAC Name | 2-[[5-(3,4-dimethoxyphenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-N-[4-(3,4-dimethylphenyl)-1,3-thiazol-2-yl]acetamide |
| SMILES | C=CCn1c(SCC(=O)Nc2nc(-c3ccc(C)c(C)c3)cs2)nnc1-c1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C26H27N5O3S2/c1-6-11-31-24(19-9-10-21(33-4)22(13-19)34-5)29-30-26(31)36-15-23(32)28-25-27-20(14-35-25)18-8-7-16(2)17(3)12-18/h6-10,12-14H,1,11,15H2,2-5H3,(H,27,28,32) |
| InChIKey | OOXQNPQDWIMAGG-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 91.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.67 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|