About 3-(1,1-dimethoxyethoxysilyl)-N-ethyl-2-methylpropan-1-amine
3-(1,1-dimethoxyethoxysilyl)-N-ethyl-2-methylpropan-1-amine (PubChem CID 173018301) has the molecular formula C10H25NO3Si
and a molecular weight of 235.40 g/mol. Its IUPAC name is 3-(1,1-dimethoxyethoxysilyl)-N-ethyl-2-methylpropan-1-amine.
Molecular Properties
| Compound Name | 3-(1,1-dimethoxyethoxysilyl)-N-ethyl-2-methylpropan-1-amine |
| PubChem CID | 173018301 |
| Molecular Formula | C10H25NO3Si |
| Molecular Weight | 235.40 g/mol |
| Exact Mass | 235.16 |
| IUPAC Name | 3-(1,1-dimethoxyethoxysilyl)-N-ethyl-2-methylpropan-1-amine |
| SMILES | CCNCC(C)C[SiH2]OC(C)(OC)OC |
| InChI | InChI=1S/C10H25NO3Si/c1-6-11-7-9(2)8-15-14-10(3,12-4)13-5/h9,11H,6-8,15H2,1-5H3 |
| InChIKey | ROPDFLXSNYBQIN-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.40 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 3-(1,1-dimethoxyethoxysilyl)-N-ethyl-2-methylpropan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(1,1-dimethoxyethoxysilyl)-N-ethyl-2-methylpropan-1-amine?
The IUPAC name of 3-(1,1-dimethoxyethoxysilyl)-N-ethyl-2-methylpropan-1-amine (CID 173018301) is 3-(1,1-dimethoxyethoxysilyl)-N-ethyl-2-methylpropan-1-amine.
What is the SMILES notation for 3-(1,1-dimethoxyethoxysilyl)-N-ethyl-2-methylpropan-1-amine?
The canonical SMILES for 3-(1,1-dimethoxyethoxysilyl)-N-ethyl-2-methylpropan-1-amine is CCNCC(C)C[SiH2]OC(C)(OC)OC.
What is the InChIKey of 3-(1,1-dimethoxyethoxysilyl)-N-ethyl-2-methylpropan-1-amine?
The InChIKey is ROPDFLXSNYBQIN-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H25NO3Si/c1-6-11-7-9(2)8-15-14-10(3,12-4)13-5/h9,11H,6-8,15H2,1-5H3.
What are the key properties of 3-(1,1-dimethoxyethoxysilyl)-N-ethyl-2-methylpropan-1-amine?
3-(1,1-dimethoxyethoxysilyl)-N-ethyl-2-methylpropan-1-amine has a molecular weight of 235.40 g/mol, XLogP of 0.72, 9 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(1,1-dimethoxyethoxysilyl)-N-ethyl-2-methylpropan-1-amine is sourced from PubChem (CID 173018301), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).