About lithium;hydride;prop-2-enyl hydrogen carbonate
lithium;hydride;prop-2-enyl hydrogen carbonate (PubChem CID 173018678) has the molecular formula C4H7LiO3
and a molecular weight of 110.04 g/mol. Its IUPAC name is lithium;hydride;prop-2-enyl hydrogen carbonate.
Molecular Properties
| Compound Name | lithium;hydride;prop-2-enyl hydrogen carbonate |
| PubChem CID | 173018678 |
| Molecular Formula | C4H7LiO3 |
| Molecular Weight | 110.04 g/mol |
| Exact Mass | 110.06 |
| IUPAC Name | lithium;hydride;prop-2-enyl hydrogen carbonate |
| SMILES | C=CCOC(=O)O.[H-].[Li+] |
| InChI | InChI=1S/C4H6O3.Li.H/c1-2-3-7-4(5)6;;/h2H,1,3H2,(H,5,6);;/q;+1;-1 |
| InChIKey | BOWAKOYEJOONJH-UHFFFAOYSA-N |
| XLogP | -2.02 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 110.04 |
| LogP ≤ 5 | -2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze lithium;hydride;prop-2-enyl hydrogen carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of lithium;hydride;prop-2-enyl hydrogen carbonate?
The IUPAC name of lithium;hydride;prop-2-enyl hydrogen carbonate (CID 173018678) is lithium;hydride;prop-2-enyl hydrogen carbonate.
What is the SMILES notation for lithium;hydride;prop-2-enyl hydrogen carbonate?
The canonical SMILES for lithium;hydride;prop-2-enyl hydrogen carbonate is C=CCOC(=O)O.[H-].[Li+].
What is the InChIKey of lithium;hydride;prop-2-enyl hydrogen carbonate?
The InChIKey is BOWAKOYEJOONJH-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H6O3.Li.H/c1-2-3-7-4(5)6;;/h2H,1,3H2,(H,5,6);;/q;+1;-1.
What are the key properties of lithium;hydride;prop-2-enyl hydrogen carbonate?
lithium;hydride;prop-2-enyl hydrogen carbonate has a molecular weight of 110.04 g/mol, XLogP of -2.02, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for lithium;hydride;prop-2-enyl hydrogen carbonate is sourced from PubChem (CID 173018678), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).