C29H36ClFN4O2 — CID 173018933
(5R,7S)-4-cyclobutylimino-1-(3-fluorophenyl)-7-methyl-8-[[3-[(1R,2S)-2-methylcyclopropyl]oxyphenyl]methyl]-1,3,8-triazaspiro[4.5]decan-2-one;hydrochloride (PubChem CID 173018933) has the molecular formula C29H36ClFN4O2 and a molecular weight of 527.08 g/mol. Its IUPAC name is (5R,7S)-4-cyclobutylimino-1-(3-fluorophenyl)-7-methyl-8-[[3-[(1R,2S)-2-methylcyclopropyl]oxyphenyl]methyl]-1,3,8-triazaspiro[4.5]decan-2-one;hydrochloride.
| Compound Name | (5R,7S)-4-cyclobutylimino-1-(3-fluorophenyl)-7-methyl-8-[[3-[(1R,2S)-2-methylcyclopropyl]oxyphenyl]methyl]-1,3,8-triazaspiro[4.5]decan-2-one;hydrochloride |
|---|---|
| PubChem CID | 173018933 |
| Molecular Formula | C29H36ClFN4O2 |
| Molecular Weight | 527.08 g/mol |
| Exact Mass | 526.25 |
| IUPAC Name | (5R,7S)-4-cyclobutylimino-1-(3-fluorophenyl)-7-methyl-8-[[3-[(1R,2S)-2-methylcyclopropyl]oxyphenyl]methyl]-1,3,8-triazaspiro[4.5]decan-2-one;hydrochloride |
| SMILES | C[C@H]1C[C@H]1Oc1cccc(CN2CC[C@@]3(C[C@@H]2C)/C(=N/C2CCC2)NC(=O)N3c2cccc(F)c2)c1.Cl |
| InChI | InChI=1S/C29H35FN4O2.ClH/c1-19-14-26(19)36-25-11-3-6-21(15-25)18-33-13-12-29(17-20(33)2)27(31-23-8-5-9-23)32-28(35)34(29)24-10-4-7-22(30)16-24;/h3-4,6-7,10-11,15-16,19-20,23,26H,5,8-9,12-14,17-18H2,1-2H3,(H,31,32,35);1H/t19-,20-,26+,29+;/m0./s1 |
| InChIKey | VXSKGDDKDCUTIL-QPZCMFHFSA-N |
| XLogP | 5.94 |
| TPSA | 57.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.08 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|