About 1,2,2-trichloroethoxysilane
1,2,2-trichloroethoxysilane (PubChem CID 173019007) has the molecular formula C2H5Cl3OSi
and a molecular weight of 179.51 g/mol. Its IUPAC name is 1,2,2-trichloroethoxysilane.
Molecular Properties
| Compound Name | 1,2,2-trichloroethoxysilane |
| PubChem CID | 173019007 |
| Molecular Formula | C2H5Cl3OSi |
| Molecular Weight | 179.51 g/mol |
| Exact Mass | 177.92 |
| IUPAC Name | 1,2,2-trichloroethoxysilane |
| SMILES | [SiH3]OC(Cl)C(Cl)Cl |
| InChI | InChI=1S/C2H5Cl3OSi/c3-1(4)2(5)6-7/h1-2H,7H3 |
| InChIKey | GDRIJBPSTJKDFY-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.51 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 1,2,2-trichloroethoxysilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2,2-trichloroethoxysilane?
The IUPAC name of 1,2,2-trichloroethoxysilane (CID 173019007) is 1,2,2-trichloroethoxysilane.
What is the SMILES notation for 1,2,2-trichloroethoxysilane?
The canonical SMILES for 1,2,2-trichloroethoxysilane is [SiH3]OC(Cl)C(Cl)Cl.
What is the InChIKey of 1,2,2-trichloroethoxysilane?
The InChIKey is GDRIJBPSTJKDFY-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H5Cl3OSi/c3-1(4)2(5)6-7/h1-2H,7H3.
What are the key properties of 1,2,2-trichloroethoxysilane?
1,2,2-trichloroethoxysilane has a molecular weight of 179.51 g/mol, XLogP of 0.65, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2,2-trichloroethoxysilane is sourced from PubChem (CID 173019007), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).