About 2-ethenyl-2-hydroxy-1,3,2-dioxaphospholan-2-ium
2-ethenyl-2-hydroxy-1,3,2-dioxaphospholan-2-ium (PubChem CID 173019471) has the molecular formula C4H8O3P+
and a molecular weight of 135.08 g/mol. Its IUPAC name is 2-ethenyl-2-hydroxy-1,3,2-dioxaphospholan-2-ium.
Molecular Properties
| Compound Name | 2-ethenyl-2-hydroxy-1,3,2-dioxaphospholan-2-ium |
| PubChem CID | 173019471 |
| Molecular Formula | C4H8O3P+ |
| Molecular Weight | 135.08 g/mol |
| Exact Mass | 135.02 |
| IUPAC Name | 2-ethenyl-2-hydroxy-1,3,2-dioxaphospholan-2-ium |
| SMILES | C=C[P+]1(O)OCCO1 |
| InChI | InChI=1S/C4H8O3P/c1-2-8(5)6-3-4-7-8/h2,5H,1,3-4H2/q+1 |
| InChIKey | KQZXMZFUSNDRKR-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 135.08 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 2-ethenyl-2-hydroxy-1,3,2-dioxaphospholan-2-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethenyl-2-hydroxy-1,3,2-dioxaphospholan-2-ium?
The IUPAC name of 2-ethenyl-2-hydroxy-1,3,2-dioxaphospholan-2-ium (CID 173019471) is 2-ethenyl-2-hydroxy-1,3,2-dioxaphospholan-2-ium.
What is the SMILES notation for 2-ethenyl-2-hydroxy-1,3,2-dioxaphospholan-2-ium?
The canonical SMILES for 2-ethenyl-2-hydroxy-1,3,2-dioxaphospholan-2-ium is C=C[P+]1(O)OCCO1.
What is the InChIKey of 2-ethenyl-2-hydroxy-1,3,2-dioxaphospholan-2-ium?
The InChIKey is KQZXMZFUSNDRKR-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H8O3P/c1-2-8(5)6-3-4-7-8/h2,5H,1,3-4H2/q+1.
What are the key properties of 2-ethenyl-2-hydroxy-1,3,2-dioxaphospholan-2-ium?
2-ethenyl-2-hydroxy-1,3,2-dioxaphospholan-2-ium has a molecular weight of 135.08 g/mol, XLogP of 0.93, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethenyl-2-hydroxy-1,3,2-dioxaphospholan-2-ium is sourced from PubChem (CID 173019471), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).