About CID 173019638
CID 173019638 (PubChem CID 173019638) has the molecular formula C16H26NaO7S
and a molecular weight of 385.43 g/mol.
Molecular Properties
| Compound Name | CID 173019638 |
| PubChem CID | 173019638 |
| Molecular Formula | C16H26NaO7S |
| Molecular Weight | 385.43 g/mol |
| Exact Mass | 385.13 |
| IUPAC Name | — |
| SMILES | O=C(O)CC(C(=O)OC1(C2CCCCC2)CCCCC1)S(=O)(=O)O.[Na] |
| InChI | InChI=1S/C16H26O7S.Na/c17-14(18)11-13(24(20,21)22)15(19)23-16(9-5-2-6-10-16)12-7-3-1-4-8-12;/h12-13H,1-11H2,(H,17,18)(H,20,21,22); |
| InChIKey | JXFDLRHAVAHRMK-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 117.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 385.43 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze CID 173019638 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 173019638?
The IUPAC name of CID 173019638 (CID 173019638) is not available.
What is the SMILES notation for CID 173019638?
The canonical SMILES for CID 173019638 is O=C(O)CC(C(=O)OC1(C2CCCCC2)CCCCC1)S(=O)(=O)O.[Na].
What is the InChIKey of CID 173019638?
The InChIKey is JXFDLRHAVAHRMK-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H26O7S.Na/c17-14(18)11-13(24(20,21)22)15(19)23-16(9-5-2-6-10-16)12-7-3-1-4-8-12;/h12-13H,1-11H2,(H,17,18)(H,20,21,22);.
What are the key properties of CID 173019638?
CID 173019638 has a molecular weight of 385.43 g/mol, XLogP of 2.16, 6 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for CID 173019638 is sourced from PubChem (CID 173019638), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).