C13H14 — CID 173020281
7,8,9,9a-tetrahydro-4H-cyclopenta[b]naphthalene (PubChem CID 173020281) has the molecular formula C13H14 and a molecular weight of 170.26 g/mol. Its IUPAC name is 7,8,9,9a-tetrahydro-4H-cyclopenta[b]naphthalene.
| Compound Name | 7,8,9,9a-tetrahydro-4H-cyclopenta[b]naphthalene |
|---|---|
| PubChem CID | 173020281 |
| Molecular Formula | C13H14 |
| Molecular Weight | 170.26 g/mol |
| Exact Mass | 170.11 |
| IUPAC Name | 7,8,9,9a-tetrahydro-4H-cyclopenta[b]naphthalene |
| SMILES | C1=CC2CC3=C(C=CCC3)CC2=C1 |
| InChI | InChI=1S/C13H14/c1-2-5-11-9-13-7-3-6-12(13)8-10(11)4-1/h1,3-4,6-7,13H,2,5,8-9H2 |
| InChIKey | NNPJXJBQYMMAOL-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.26 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |