About 5a,6,7,8,9,9a-hexahydro-1H-cyclopenta[a]naphthalene
5a,6,7,8,9,9a-hexahydro-1H-cyclopenta[a]naphthalene (PubChem CID 173020363) has the molecular formula C13H16
and a molecular weight of 172.27 g/mol. Its IUPAC name is 5a,6,7,8,9,9a-hexahydro-1H-cyclopenta[a]naphthalene.
Analyze 5a,6,7,8,9,9a-hexahydro-1H-cyclopenta[a]naphthalene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5a,6,7,8,9,9a-hexahydro-1H-cyclopenta[a]naphthalene?
The IUPAC name of 5a,6,7,8,9,9a-hexahydro-1H-cyclopenta[a]naphthalene (CID 173020363) is 5a,6,7,8,9,9a-hexahydro-1H-cyclopenta[a]naphthalene.
What is the SMILES notation for 5a,6,7,8,9,9a-hexahydro-1H-cyclopenta[a]naphthalene?
The canonical SMILES for 5a,6,7,8,9,9a-hexahydro-1H-cyclopenta[a]naphthalene is C1=CC2=C(C1)C1CCCCC1C=C2.
What is the InChIKey of 5a,6,7,8,9,9a-hexahydro-1H-cyclopenta[a]naphthalene?
The InChIKey is XDKMVXWYFAFXKO-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16/c1-2-6-12-10(4-1)8-9-11-5-3-7-13(11)12/h3,5,8-10,12H,1-2,4,6-7H2.
What are the key properties of 5a,6,7,8,9,9a-hexahydro-1H-cyclopenta[a]naphthalene?
5a,6,7,8,9,9a-hexahydro-1H-cyclopenta[a]naphthalene has a molecular weight of 172.27 g/mol, XLogP of 3.62, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 5a,6,7,8,9,9a-hexahydro-1H-cyclopenta[a]naphthalene is sourced from PubChem (CID 173020363), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).